C14H10F3NO2 — CID 172909577
2-(4-methylphenyl)-5-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 172909577) has the molecular formula C14H10F3NO2 and a molecular weight of 281.23 g/mol. Its IUPAC name is 2-(4-methylphenyl)-5-(trifluoromethyl)pyridine-3-carboxylic acid.
| Compound Name | 2-(4-methylphenyl)-5-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 172909577 |
| Molecular Formula | C14H10F3NO2 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-(4-methylphenyl)-5-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | Cc1ccc(-c2ncc(C(F)(F)F)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C14H10F3NO2/c1-8-2-4-9(5-3-8)12-11(13(19)20)6-10(7-18-12)14(15,16)17/h2-7H,1H3,(H,19,20) |
| InChIKey | QBYGHOSEADJCDS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |