C13H6Cl2F3NO2 — CID 68945828
2-chloro-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]benzoic acid (PubChem CID 68945828) has the molecular formula C13H6Cl2F3NO2 and a molecular weight of 336.10 g/mol. Its IUPAC name is 2-chloro-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]benzoic acid.
| Compound Name | 2-chloro-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 68945828 |
| Molecular Formula | C13H6Cl2F3NO2 |
| Molecular Weight | 336.10 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | 2-chloro-4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ncc(C(F)(F)F)cc2Cl)cc1Cl |
| InChI | InChI=1S/C13H6Cl2F3NO2/c14-9-3-6(1-2-8(9)12(20)21)11-10(15)4-7(5-19-11)13(16,17)18/h1-5H,(H,20,21) |
| InChIKey | LTJAGOMUCAMIIR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.10 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |