C20H11F6NO2 — CID 134618070
2,5-bis[4-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid (PubChem CID 134618070) has the molecular formula C20H11F6NO2 and a molecular weight of 411.30 g/mol. Its IUPAC name is 2,5-bis[4-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid.
| Compound Name | 2,5-bis[4-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 134618070 |
| Molecular Formula | C20H11F6NO2 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 2,5-bis[4-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(C(F)(F)F)cc2)cnc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H11F6NO2/c21-19(22,23)14-5-1-11(2-6-14)13-9-16(18(28)29)17(27-10-13)12-3-7-15(8-4-12)20(24,25)26/h1-10H,(H,28,29) |
| InChIKey | SKMKBXIVIARJLI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |