C19H11F6N — CID 134623472
3,5-bis[4-(trifluoromethyl)phenyl]pyridine (PubChem CID 134623472) has the molecular formula C19H11F6N and a molecular weight of 367.29 g/mol. Its IUPAC name is 3,5-bis[4-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 3,5-bis[4-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 134623472 |
| Molecular Formula | C19H11F6N |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 3,5-bis[4-(trifluoromethyl)phenyl]pyridine |
| SMILES | FC(F)(F)c1ccc(-c2cncc(-c3ccc(C(F)(F)F)cc3)c2)cc1 |
| InChI | InChI=1S/C19H11F6N/c20-18(21,22)16-5-1-12(2-6-16)14-9-15(11-26-10-14)13-3-7-17(8-4-13)19(23,24)25/h1-11H |
| InChIKey | JLQACDBVBNIOMS-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |