C18H10F6N2 — CID 44532794
2,6-bis[4-(trifluoromethyl)phenyl]pyrazine (PubChem CID 44532794) has the molecular formula C18H10F6N2 and a molecular weight of 368.28 g/mol. Its IUPAC name is 2,6-bis[4-(trifluoromethyl)phenyl]pyrazine.
| Compound Name | 2,6-bis[4-(trifluoromethyl)phenyl]pyrazine |
|---|---|
| PubChem CID | 44532794 |
| Molecular Formula | C18H10F6N2 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 2,6-bis[4-(trifluoromethyl)phenyl]pyrazine |
| SMILES | FC(F)(F)c1ccc(-c2cncc(-c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C18H10F6N2/c19-17(20,21)13-5-1-11(2-6-13)15-9-25-10-16(26-15)12-3-7-14(8-4-12)18(22,23)24/h1-10H |
| InChIKey | JSZNVHANCCQBGN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |