C10H6F3N3 — CID 154214481
2-[4-(trifluoromethyl)phenyl]-1,3,5-triazine (PubChem CID 154214481) has the molecular formula C10H6F3N3 and a molecular weight of 225.17 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 154214481 |
| Molecular Formula | C10H6F3N3 |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]-1,3,5-triazine |
| SMILES | FC(F)(F)c1ccc(-c2ncncn2)cc1 |
| InChI | InChI=1S/C10H6F3N3/c11-10(12,13)8-3-1-7(2-4-8)9-15-5-14-6-16-9/h1-6H |
| InChIKey | RSMNNGLHWNRLGG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |