C23H15F3N2 — CID 59806456
2,3-diphenyl-5-[4-(trifluoromethyl)phenyl]pyrazine (PubChem CID 59806456) has the molecular formula C23H15F3N2 and a molecular weight of 376.38 g/mol. Its IUPAC name is 2,3-diphenyl-5-[4-(trifluoromethyl)phenyl]pyrazine.
| Compound Name | 2,3-diphenyl-5-[4-(trifluoromethyl)phenyl]pyrazine |
|---|---|
| PubChem CID | 59806456 |
| Molecular Formula | C23H15F3N2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2,3-diphenyl-5-[4-(trifluoromethyl)phenyl]pyrazine |
| SMILES | FC(F)(F)c1ccc(-c2cnc(-c3ccccc3)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H15F3N2/c24-23(25,26)19-13-11-16(12-14-19)20-15-27-21(17-7-3-1-4-8-17)22(28-20)18-9-5-2-6-10-18/h1-15H |
| InChIKey | SZGMYMJULCBYFQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |