C28H20N2 — CID 58991364
2,3-diphenyl-5-(4-phenylphenyl)pyrazine (PubChem CID 58991364) has the molecular formula C28H20N2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2,3-diphenyl-5-(4-phenylphenyl)pyrazine.
| Compound Name | 2,3-diphenyl-5-(4-phenylphenyl)pyrazine |
|---|---|
| PubChem CID | 58991364 |
| Molecular Formula | C28H20N2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2,3-diphenyl-5-(4-phenylphenyl)pyrazine |
| SMILES | c1ccc(-c2ccc(-c3cnc(-c4ccccc4)c(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C28H20N2/c1-4-10-21(11-5-1)22-16-18-23(19-17-22)26-20-29-27(24-12-6-2-7-13-24)28(30-26)25-14-8-3-9-15-25/h1-20H |
| InChIKey | CSKSXFKZFXMERK-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |