C23H15N3 — CID 66672885
3-(5,6-diphenylpyrazin-2-yl)benzonitrile (PubChem CID 66672885) has the molecular formula C23H15N3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 3-(5,6-diphenylpyrazin-2-yl)benzonitrile.
| Compound Name | 3-(5,6-diphenylpyrazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 66672885 |
| Molecular Formula | C23H15N3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 3-(5,6-diphenylpyrazin-2-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2cnc(-c3ccccc3)c(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H15N3/c24-15-17-8-7-13-20(14-17)21-16-25-22(18-9-3-1-4-10-18)23(26-21)19-11-5-2-6-12-19/h1-14,16H |
| InChIKey | XHPBHJKPYKHWDD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |