C35H19N5 — CID 167064080
7-(3-cyanophenyl)-2,3-diphenylpyrazino[2,3-k]phenanthridine-5-carbonitrile (PubChem CID 167064080) has the molecular formula C35H19N5 and a molecular weight of 509.57 g/mol. Its IUPAC name is 7-(3-cyanophenyl)-2,3-diphenylpyrazino[2,3-k]phenanthridine-5-carbonitrile.
| Compound Name | 7-(3-cyanophenyl)-2,3-diphenylpyrazino[2,3-k]phenanthridine-5-carbonitrile |
|---|---|
| PubChem CID | 167064080 |
| Molecular Formula | C35H19N5 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 7-(3-cyanophenyl)-2,3-diphenylpyrazino[2,3-k]phenanthridine-5-carbonitrile |
| SMILES | N#Cc1cccc(-c2nc3ccccc3c3c2cc(C#N)c2nc(-c4ccccc4)c(-c4ccccc4)nc23)c1 |
| InChI | InChI=1S/C35H19N5/c36-20-22-10-9-15-25(18-22)31-28-19-26(21-37)34-35(30(28)27-16-7-8-17-29(27)38-31)40-33(24-13-5-2-6-14-24)32(39-34)23-11-3-1-4-12-23/h1-19H |
| InChIKey | LULPRHNNZCWOCE-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|