C41H18F5N5 — CID 167064277
4-[2-(4-cyanophenyl)-7-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrazino[2,3-k]phenanthridin-3-yl]benzonitrile (PubChem CID 167064277) has the molecular formula C41H18F5N5 and a molecular weight of 675.62 g/mol. Its IUPAC name is 4-[2-(4-cyanophenyl)-7-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrazino[2,3-k]phenanthridin-3-yl]benzonitrile.
| Compound Name | 4-[2-(4-cyanophenyl)-7-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrazino[2,3-k]phenanthridin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 167064277 |
| Molecular Formula | C41H18F5N5 |
| Molecular Weight | 675.62 g/mol |
| Exact Mass | 675.15 |
| IUPAC Name | 4-[2-(4-cyanophenyl)-7-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrazino[2,3-k]phenanthridin-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc3ccc4c(-c5cccc(-c6c(F)c(F)c(F)c(F)c6F)c5)nc5ccccc5c4c3nc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C41H18F5N5/c42-33-31(34(43)36(45)37(46)35(33)44)25-4-3-5-26(18-25)38-28-16-17-30-41(32(28)27-6-1-2-7-29(27)49-38)51-40(24-14-10-22(20-48)11-15-24)39(50-30)23-12-8-21(19-47)9-13-23/h1-18H |
| InChIKey | PMWFUEYIDSPQKQ-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.62 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|