C41H20F3N5 — CID 167063988
4-[2-(4-cyanophenyl)-7-[3-(3,4,5-trifluorophenyl)phenyl]pyrazino[2,3-k]phenanthridin-3-yl]benzonitrile (PubChem CID 167063988) has the molecular formula C41H20F3N5 and a molecular weight of 639.64 g/mol. Its IUPAC name is 4-[2-(4-cyanophenyl)-7-[3-(3,4,5-trifluorophenyl)phenyl]pyrazino[2,3-k]phenanthridin-3-yl]benzonitrile.
| Compound Name | 4-[2-(4-cyanophenyl)-7-[3-(3,4,5-trifluorophenyl)phenyl]pyrazino[2,3-k]phenanthridin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 167063988 |
| Molecular Formula | C41H20F3N5 |
| Molecular Weight | 639.64 g/mol |
| Exact Mass | 639.17 |
| IUPAC Name | 4-[2-(4-cyanophenyl)-7-[3-(3,4,5-trifluorophenyl)phenyl]pyrazino[2,3-k]phenanthridin-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc3ccc4c(-c5cccc(-c6cc(F)c(F)c(F)c6)c5)nc5ccccc5c4c3nc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C41H20F3N5/c42-32-19-29(20-33(43)37(32)44)27-4-3-5-28(18-27)38-31-16-17-35-41(36(31)30-6-1-2-7-34(30)47-38)49-40(26-14-10-24(22-46)11-15-26)39(48-35)25-12-8-23(21-45)9-13-25/h1-20H |
| InChIKey | OZXLGUHKPSGCMD-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.64 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|