C40H21F3N4 — CID 167064200
2,3-diphenyl-5-[3-(3,4,5-trifluorophenyl)phenyl]pyrazino[2,3-i]phenanthridine-11-carbonitrile (PubChem CID 167064200) has the molecular formula C40H21F3N4 and a molecular weight of 614.63 g/mol. Its IUPAC name is 2,3-diphenyl-5-[3-(3,4,5-trifluorophenyl)phenyl]pyrazino[2,3-i]phenanthridine-11-carbonitrile.
| Compound Name | 2,3-diphenyl-5-[3-(3,4,5-trifluorophenyl)phenyl]pyrazino[2,3-i]phenanthridine-11-carbonitrile |
|---|---|
| PubChem CID | 167064200 |
| Molecular Formula | C40H21F3N4 |
| Molecular Weight | 614.63 g/mol |
| Exact Mass | 614.17 |
| IUPAC Name | 2,3-diphenyl-5-[3-(3,4,5-trifluorophenyl)phenyl]pyrazino[2,3-i]phenanthridine-11-carbonitrile |
| SMILES | N#Cc1cc2nc(-c3ccccc3)c(-c3ccccc3)nc2c2c(-c3cccc(-c4cc(F)c(F)c(F)c4)c3)nc3ccccc3c12 |
| InChI | InChI=1S/C40H21F3N4/c41-30-19-27(20-31(42)36(30)43)25-14-9-15-26(18-25)37-35-34(29-16-7-8-17-32(29)45-37)28(22-44)21-33-40(35)47-39(24-12-5-2-6-13-24)38(46-33)23-10-3-1-4-11-23/h1-21H |
| InChIKey | WKMGTOQITCWMNN-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.63 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|