C42H19F3N6 — CID 164767970
2,3-bis(4-isocyanophenyl)-5-[2-(3,4,5-trifluorophenyl)phenyl]pyrazino[2,3-i]phenanthridine-11-carbonitrile (PubChem CID 164767970) has the molecular formula C42H19F3N6 and a molecular weight of 664.65 g/mol. Its IUPAC name is 2,3-bis(4-isocyanophenyl)-5-[2-(3,4,5-trifluorophenyl)phenyl]pyrazino[2,3-i]phenanthridine-11-carbonitrile.
| Compound Name | 2,3-bis(4-isocyanophenyl)-5-[2-(3,4,5-trifluorophenyl)phenyl]pyrazino[2,3-i]phenanthridine-11-carbonitrile |
|---|---|
| PubChem CID | 164767970 |
| Molecular Formula | C42H19F3N6 |
| Molecular Weight | 664.65 g/mol |
| Exact Mass | 664.16 |
| IUPAC Name | 2,3-bis(4-isocyanophenyl)-5-[2-(3,4,5-trifluorophenyl)phenyl]pyrazino[2,3-i]phenanthridine-11-carbonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2nc3cc(C#N)c4c5ccccc5nc(-c5ccccc5-c5cc(F)c(F)c(F)c5)c4c3nc2-c2ccc([N+]#[C-])cc2)cc1 |
| InChI | InChI=1S/C42H19F3N6/c1-47-27-15-11-23(12-16-27)39-40(24-13-17-28(48-2)18-14-24)51-42-35(50-39)21-26(22-46)36-31-9-5-6-10-34(31)49-41(37(36)42)30-8-4-3-7-29(30)25-19-32(43)38(45)33(44)20-25/h3-21H |
| InChIKey | MHZCJIWPMLWIJW-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 71.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.65 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|