C42H22N6 — CID 167064151
5-[4-(11-cyano-2,3-diphenylpyrazino[2,3-i]phenanthridin-5-yl)phenyl]benzene-1,3-dicarbonitrile (PubChem CID 167064151) has the molecular formula C42H22N6 and a molecular weight of 610.68 g/mol. Its IUPAC name is 5-[4-(11-cyano-2,3-diphenylpyrazino[2,3-i]phenanthridin-5-yl)phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[4-(11-cyano-2,3-diphenylpyrazino[2,3-i]phenanthridin-5-yl)phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 167064151 |
| Molecular Formula | C42H22N6 |
| Molecular Weight | 610.68 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | 5-[4-(11-cyano-2,3-diphenylpyrazino[2,3-i]phenanthridin-5-yl)phenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(-c2ccc(-c3nc4ccccc4c4c(C#N)cc5nc(-c6ccccc6)c(-c6ccccc6)nc5c34)cc2)c1 |
| InChI | InChI=1S/C42H22N6/c43-23-26-19-27(24-44)21-32(20-26)28-15-17-31(18-16-28)39-38-37(34-13-7-8-14-35(34)46-39)33(25-45)22-36-42(38)48-41(30-11-5-2-6-12-30)40(47-36)29-9-3-1-4-10-29/h1-22H |
| InChIKey | FWBIRMSXAHHJDY-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 110.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.68 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|