C44H20N8 — CID 164767960
5-[2,3,5-tris(4-isocyanophenyl)pyrazino[2,3-i]phenanthridin-11-yl]benzene-1,3-dicarbonitrile (PubChem CID 164767960) has the molecular formula C44H20N8 and a molecular weight of 660.70 g/mol. Its IUPAC name is 5-[2,3,5-tris(4-isocyanophenyl)pyrazino[2,3-i]phenanthridin-11-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[2,3,5-tris(4-isocyanophenyl)pyrazino[2,3-i]phenanthridin-11-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 164767960 |
| Molecular Formula | C44H20N8 |
| Molecular Weight | 660.70 g/mol |
| Exact Mass | 660.18 |
| IUPAC Name | 5-[2,3,5-tris(4-isocyanophenyl)pyrazino[2,3-i]phenanthridin-11-yl]benzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2nc3cc(-c4cc(C#N)cc(C#N)c4)c4c5ccccc5nc(-c5ccc([N+]#[C-])cc5)c4c3nc2-c2ccc([N+]#[C-])cc2)cc1 |
| InChI | InChI=1S/C44H20N8/c1-47-32-14-8-28(9-15-32)41-40-39(35-6-4-5-7-37(35)50-41)36(31-21-26(24-45)20-27(22-31)25-46)23-38-44(40)52-43(30-12-18-34(49-3)19-13-30)42(51-38)29-10-16-33(48-2)17-11-29/h4-23H |
| InChIKey | RQWYDLVZZIGJJH-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 99.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.70 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|