C43H21N7 — CID 164767823
4-[5-(3,5-diisocyanophenyl)-3-(4-isocyanophenyl)-7-phenylpyrazino[2,3-k]phenanthridin-2-yl]benzonitrile (PubChem CID 164767823) has the molecular formula C43H21N7 and a molecular weight of 635.69 g/mol. Its IUPAC name is 4-[5-(3,5-diisocyanophenyl)-3-(4-isocyanophenyl)-7-phenylpyrazino[2,3-k]phenanthridin-2-yl]benzonitrile.
| Compound Name | 4-[5-(3,5-diisocyanophenyl)-3-(4-isocyanophenyl)-7-phenylpyrazino[2,3-k]phenanthridin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 164767823 |
| Molecular Formula | C43H21N7 |
| Molecular Weight | 635.69 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | 4-[5-(3,5-diisocyanophenyl)-3-(4-isocyanophenyl)-7-phenylpyrazino[2,3-k]phenanthridin-2-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2nc3c(-c4cc([N+]#[C-])cc([N+]#[C-])c4)cc4c(-c5ccccc5)nc5ccccc5c4c3nc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C43H21N7/c1-45-31-19-17-29(18-20-31)40-41(28-15-13-26(25-44)14-16-28)50-43-38-34-11-7-8-12-37(34)48-39(27-9-5-4-6-10-27)36(38)24-35(42(43)49-40)30-21-32(46-2)23-33(22-30)47-3/h4-24H |
| InChIKey | XTQHQBDWUJLGGI-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 75.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.69 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|