C42H17F5N6 — CID 164767761
4-[6-isocyano-3-(4-isocyanophenyl)-7-[2-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrazino[2,3-k]phenanthridin-2-yl]benzonitrile (PubChem CID 164767761) has the molecular formula C42H17F5N6 and a molecular weight of 700.63 g/mol. Its IUPAC name is 4-[6-isocyano-3-(4-isocyanophenyl)-7-[2-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrazino[2,3-k]phenanthridin-2-yl]benzonitrile.
| Compound Name | 4-[6-isocyano-3-(4-isocyanophenyl)-7-[2-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrazino[2,3-k]phenanthridin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 164767761 |
| Molecular Formula | C42H17F5N6 |
| Molecular Weight | 700.63 g/mol |
| Exact Mass | 700.14 |
| IUPAC Name | 4-[6-isocyano-3-(4-isocyanophenyl)-7-[2-(2,3,4,5,6-pentafluorophenyl)phenyl]pyrazino[2,3-k]phenanthridin-2-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2nc3cc([N+]#[C-])c4c(-c5ccccc5-c5c(F)c(F)c(F)c(F)c5F)nc5ccccc5c4c3nc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C42H17F5N6/c1-49-24-17-15-23(16-18-24)39-40(22-13-11-21(20-48)12-14-22)53-42-30(52-39)19-29(50-2)33-31(42)27-9-5-6-10-28(27)51-41(33)26-8-4-3-7-25(26)32-34(43)36(45)38(47)37(46)35(32)44/h3-19H |
| InChIKey | YAAQDXKIHGDNHU-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 71.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.63 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|