C48H22F4N6 — CID 167064208
4-[2-[2,3-bis(4-cyanophenyl)-11-phenylpyrazino[2,3-i]phenanthridin-5-yl]phenyl]-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 167064208) has the molecular formula C48H22F4N6 and a molecular weight of 758.74 g/mol. Its IUPAC name is 4-[2-[2,3-bis(4-cyanophenyl)-11-phenylpyrazino[2,3-i]phenanthridin-5-yl]phenyl]-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-[2-[2,3-bis(4-cyanophenyl)-11-phenylpyrazino[2,3-i]phenanthridin-5-yl]phenyl]-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 167064208 |
| Molecular Formula | C48H22F4N6 |
| Molecular Weight | 758.74 g/mol |
| Exact Mass | 758.18 |
| IUPAC Name | 4-[2-[2,3-bis(4-cyanophenyl)-11-phenylpyrazino[2,3-i]phenanthridin-5-yl]phenyl]-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | N#Cc1ccc(-c2nc3cc(-c4ccccc4)c4c5ccccc5nc(-c5ccccc5-c5c(F)c(F)c(C#N)c(F)c5F)c4c3nc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C48H22F4N6/c49-41-35(25-55)42(50)44(52)39(43(41)51)31-10-4-5-11-32(31)47-40-38(33-12-6-7-13-36(33)56-47)34(28-8-2-1-3-9-28)22-37-48(40)58-46(30-20-16-27(24-54)17-21-30)45(57-37)29-18-14-26(23-53)15-19-29/h1-22H |
| InChIKey | YXCATPUECVBRIX-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 110.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.74 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|