C37H17N7 — CID 167064013
2,3,5-tris(4-cyanophenyl)pyrazino[2,3-i]phenanthridine-11-carbonitrile (PubChem CID 167064013) has the molecular formula C37H17N7 and a molecular weight of 559.59 g/mol. Its IUPAC name is 2,3,5-tris(4-cyanophenyl)pyrazino[2,3-i]phenanthridine-11-carbonitrile.
| Compound Name | 2,3,5-tris(4-cyanophenyl)pyrazino[2,3-i]phenanthridine-11-carbonitrile |
|---|---|
| PubChem CID | 167064013 |
| Molecular Formula | C37H17N7 |
| Molecular Weight | 559.59 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | 2,3,5-tris(4-cyanophenyl)pyrazino[2,3-i]phenanthridine-11-carbonitrile |
| SMILES | N#Cc1ccc(-c2nc3cc(C#N)c4c5ccccc5nc(-c5ccc(C#N)cc5)c4c3nc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C37H17N7/c38-18-22-5-11-25(12-6-22)34-33-32(29-3-1-2-4-30(29)42-34)28(21-41)17-31-37(33)44-36(27-15-9-24(20-40)10-16-27)35(43-31)26-13-7-23(19-39)8-14-26/h1-17H |
| InChIKey | GNMINJCXHOWQAR-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 133.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.59 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|