C40H19F5N4 — CID 167064086
7-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3-diphenylpyrazino[2,3-k]phenanthridine-6-carbonitrile (PubChem CID 167064086) has the molecular formula C40H19F5N4 and a molecular weight of 650.61 g/mol. Its IUPAC name is 7-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3-diphenylpyrazino[2,3-k]phenanthridine-6-carbonitrile.
| Compound Name | 7-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3-diphenylpyrazino[2,3-k]phenanthridine-6-carbonitrile |
|---|---|
| PubChem CID | 167064086 |
| Molecular Formula | C40H19F5N4 |
| Molecular Weight | 650.61 g/mol |
| Exact Mass | 650.15 |
| IUPAC Name | 7-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3-diphenylpyrazino[2,3-k]phenanthridine-6-carbonitrile |
| SMILES | N#Cc1cc2nc(-c3ccccc3)c(-c3ccccc3)nc2c2c1c(-c1cccc(-c3c(F)c(F)c(F)c(F)c3F)c1)nc1ccccc12 |
| InChI | InChI=1S/C40H19F5N4/c41-32-30(33(42)35(44)36(45)34(32)43)23-14-9-15-24(18-23)37-29-25(20-46)19-28-40(31(29)26-16-7-8-17-27(26)47-37)49-39(22-12-5-2-6-13-22)38(48-28)21-10-3-1-4-11-21/h1-19H |
| InChIKey | PZWUADPUJAXXQC-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.61 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|