C40H22F5N3 — CID 165002252
6-methyl-7-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3-diphenylpyrazino[2,3-k]phenanthridine (PubChem CID 165002252) has the molecular formula C40H22F5N3 and a molecular weight of 639.63 g/mol. Its IUPAC name is 6-methyl-7-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3-diphenylpyrazino[2,3-k]phenanthridine.
| Compound Name | 6-methyl-7-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3-diphenylpyrazino[2,3-k]phenanthridine |
|---|---|
| PubChem CID | 165002252 |
| Molecular Formula | C40H22F5N3 |
| Molecular Weight | 639.63 g/mol |
| Exact Mass | 639.17 |
| IUPAC Name | 6-methyl-7-[3-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3-diphenylpyrazino[2,3-k]phenanthridine |
| SMILES | Cc1cc2nc(-c3ccccc3)c(-c3ccccc3)nc2c2c1c(-c1cccc(-c3c(F)c(F)c(F)c(F)c3F)c1)nc1ccccc12 |
| InChI | InChI=1S/C40H22F5N3/c1-21-19-28-40(48-39(23-13-6-3-7-14-23)38(47-28)22-11-4-2-5-12-22)31-26-17-8-9-18-27(26)46-37(29(21)31)25-16-10-15-24(20-25)30-32(41)34(43)36(45)35(44)33(30)42/h2-20H,1H3 |
| InChIKey | DQGHWMCFRCDZFV-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.63 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|