C40H19F8N3 — CID 167064162
7-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3-diphenyl-6-(trifluoromethyl)pyrazino[2,3-k]phenanthridine (PubChem CID 167064162) has the molecular formula C40H19F8N3 and a molecular weight of 693.60 g/mol. Its IUPAC name is 7-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3-diphenyl-6-(trifluoromethyl)pyrazino[2,3-k]phenanthridine.
| Compound Name | 7-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3-diphenyl-6-(trifluoromethyl)pyrazino[2,3-k]phenanthridine |
|---|---|
| PubChem CID | 167064162 |
| Molecular Formula | C40H19F8N3 |
| Molecular Weight | 693.60 g/mol |
| Exact Mass | 693.15 |
| IUPAC Name | 7-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3-diphenyl-6-(trifluoromethyl)pyrazino[2,3-k]phenanthridine |
| SMILES | Fc1c(F)c(F)c(-c2ccc(-c3nc4ccccc4c4c3c(C(F)(F)F)cc3nc(-c5ccccc5)c(-c5ccccc5)nc34)cc2)c(F)c1F |
| InChI | InChI=1S/C40H19F8N3/c41-31-28(32(42)34(44)35(45)33(31)43)20-15-17-23(18-16-20)36-30-25(40(46,47)48)19-27-39(29(30)24-13-7-8-14-26(24)49-36)51-38(22-11-5-2-6-12-22)37(50-27)21-9-3-1-4-10-21/h1-19H |
| InChIKey | LOBNGPHHLBQZMM-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.60 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|