C50H30F3N5 — CID 167064149
7-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]-2,3-diphenyl-6-(trifluoromethyl)pyrazino[2,3-k]phenanthridine (PubChem CID 167064149) has the molecular formula C50H30F3N5 and a molecular weight of 757.82 g/mol. Its IUPAC name is 7-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]-2,3-diphenyl-6-(trifluoromethyl)pyrazino[2,3-k]phenanthridine.
| Compound Name | 7-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]-2,3-diphenyl-6-(trifluoromethyl)pyrazino[2,3-k]phenanthridine |
|---|---|
| PubChem CID | 167064149 |
| Molecular Formula | C50H30F3N5 |
| Molecular Weight | 757.82 g/mol |
| Exact Mass | 757.25 |
| IUPAC Name | 7-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]-2,3-diphenyl-6-(trifluoromethyl)pyrazino[2,3-k]phenanthridine |
| SMILES | FC(F)(F)c1cc2nc(-c3ccccc3)c(-c3ccccc3)nc2c2c1c(-c1ccccc1-c1cc(-c3ccccc3)nc(-c3ccccc3)n1)nc1ccccc12 |
| InChI | InChI=1S/C50H30F3N5/c51-50(52,53)38-29-42-48(58-46(33-21-9-3-10-22-33)45(55-42)32-19-7-2-8-20-32)43-37-27-15-16-28-39(37)54-47(44(38)43)36-26-14-13-25-35(36)41-30-40(31-17-5-1-6-18-31)56-49(57-41)34-23-11-4-12-24-34/h1-30H |
| InChIKey | IGKAWLXZNWYHRL-UHFFFAOYSA-N |
| XLogP | 13.14 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.82 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|