C50H30N6 — CID 167064229
7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-2,3-diphenylpyrazino[2,3-k]phenanthridine-6-carbonitrile (PubChem CID 167064229) has the molecular formula C50H30N6 and a molecular weight of 714.83 g/mol. Its IUPAC name is 7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-2,3-diphenylpyrazino[2,3-k]phenanthridine-6-carbonitrile.
| Compound Name | 7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-2,3-diphenylpyrazino[2,3-k]phenanthridine-6-carbonitrile |
|---|---|
| PubChem CID | 167064229 |
| Molecular Formula | C50H30N6 |
| Molecular Weight | 714.83 g/mol |
| Exact Mass | 714.25 |
| IUPAC Name | 7-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-2,3-diphenylpyrazino[2,3-k]phenanthridine-6-carbonitrile |
| SMILES | N#Cc1cc2nc(-c3ccccc3)c(-c3ccccc3)nc2c2c1c(-c1ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc1)nc1ccccc12 |
| InChI | InChI=1S/C50H30N6/c51-31-38-29-43-49(56-48(35-19-9-3-10-20-35)47(53-43)34-17-7-2-8-18-34)45-39-23-13-14-24-40(39)52-46(44(38)45)36-27-25-33(26-28-36)42-30-41(32-15-5-1-6-16-32)54-50(55-42)37-21-11-4-12-22-37/h1-30H |
| InChIKey | JYJADKZVXFTOAM-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.83 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|