C50H30N6 — CID 164767619
7-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]-6-isocyano-2,3-diphenylpyrazino[2,3-k]phenanthridine (PubChem CID 164767619) has the molecular formula C50H30N6 and a molecular weight of 714.83 g/mol. Its IUPAC name is 7-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]-6-isocyano-2,3-diphenylpyrazino[2,3-k]phenanthridine.
| Compound Name | 7-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]-6-isocyano-2,3-diphenylpyrazino[2,3-k]phenanthridine |
|---|---|
| PubChem CID | 164767619 |
| Molecular Formula | C50H30N6 |
| Molecular Weight | 714.83 g/mol |
| Exact Mass | 714.25 |
| IUPAC Name | 7-[2-(2,6-diphenylpyrimidin-4-yl)phenyl]-6-isocyano-2,3-diphenylpyrazino[2,3-k]phenanthridine |
| SMILES | [C-]#[N+]c1cc2nc(-c3ccccc3)c(-c3ccccc3)nc2c2c1c(-c1ccccc1-c1cc(-c3ccccc3)nc(-c3ccccc3)n1)nc1ccccc12 |
| InChI | InChI=1S/C50H30N6/c1-51-42-31-43-49(56-47(34-22-10-4-11-23-34)46(53-43)33-20-8-3-9-21-33)44-38-28-16-17-29-39(38)52-48(45(42)44)37-27-15-14-26-36(37)41-30-40(32-18-6-2-7-19-32)54-50(55-41)35-24-12-5-13-25-35/h2-31H |
| InChIKey | ZNZWISIKYRKWAS-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 68.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.83 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|