C47H31N3 — CID 146548653
3-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-6,10-diphenylphenanthridine (PubChem CID 146548653) has the molecular formula C47H31N3 and a molecular weight of 637.79 g/mol. Its IUPAC name is 3-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-6,10-diphenylphenanthridine.
| Compound Name | 3-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-6,10-diphenylphenanthridine |
|---|---|
| PubChem CID | 146548653 |
| Molecular Formula | C47H31N3 |
| Molecular Weight | 637.79 g/mol |
| Exact Mass | 637.25 |
| IUPAC Name | 3-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-6,10-diphenylphenanthridine |
| SMILES | c1ccc(-c2cc(-c3cccc(-c4ccc5c(c4)nc(-c4ccccc4)c4cccc(-c6ccccc6)c45)c3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C47H31N3/c1-5-15-32(16-6-1)39-25-14-26-41-45(39)40-28-27-37(30-44(40)48-46(41)34-19-9-3-10-20-34)36-23-13-24-38(29-36)43-31-42(33-17-7-2-8-18-33)49-47(50-43)35-21-11-4-12-22-35/h1-31H |
| InChIKey | MVOSAYPIGOUAIK-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.79 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|