C58H39N4P — CID 163523054
[4-[4-[4-(6,10-diphenylphenanthridin-3-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-diphenylphosphane (PubChem CID 163523054) has the molecular formula C58H39N4P and a molecular weight of 822.95 g/mol. Its IUPAC name is [4-[4-[4-(6,10-diphenylphenanthridin-3-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-diphenylphosphane.
| Compound Name | [4-[4-[4-(6,10-diphenylphenanthridin-3-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 163523054 |
| Molecular Formula | C58H39N4P |
| Molecular Weight | 822.95 g/mol |
| Exact Mass | 822.29 |
| IUPAC Name | [4-[4-[4-(6,10-diphenylphenanthridin-3-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-diphenylphosphane |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4ccc5c(c4)nc(-c4ccccc4)c4cccc(-c6ccccc6)c45)cc3)nc(-c3ccc(P(c4ccccc4)c4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C58H39N4P/c1-6-17-41(18-7-1)50-27-16-28-52-54(50)51-38-35-46(39-53(51)59-55(52)42-19-8-2-9-20-42)40-29-31-44(32-30-40)57-60-56(43-21-10-3-11-22-43)61-58(62-57)45-33-36-49(37-34-45)63(47-23-12-4-13-24-47)48-25-14-5-15-26-48/h1-39H |
| InChIKey | DMMLVJKICJPSHX-UHFFFAOYSA-N |
| XLogP | 13.33 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.95 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|