C44H28N5+ — CID 153242000
3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-phenyl-6-pyrrol-1-ium-3-ylphenanthridine (PubChem CID 153242000) has the molecular formula C44H28N5+ and a molecular weight of 626.74 g/mol. Its IUPAC name is 3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-phenyl-6-pyrrol-1-ium-3-ylphenanthridine.
| Compound Name | 3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-phenyl-6-pyrrol-1-ium-3-ylphenanthridine |
|---|---|
| PubChem CID | 153242000 |
| Molecular Formula | C44H28N5+ |
| Molecular Weight | 626.74 g/mol |
| Exact Mass | 626.23 |
| IUPAC Name | 3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10-phenyl-6-pyrrol-1-ium-3-ylphenanthridine |
| SMILES | C1=[N+]=CC(c2nc3cc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)ccc3c3c(-c4ccccc4)cccc23)=C1 |
| InChI | InChI=1S/C44H28N5/c1-4-11-30(12-5-1)36-17-10-18-38-40(36)37-24-23-34(27-39(37)46-41(38)35-25-26-45-28-35)29-19-21-33(22-20-29)44-48-42(31-13-6-2-7-14-31)47-43(49-44)32-15-8-3-9-16-32/h1-28H/q+1 |
| InChIKey | UUAOBHXGBZGJFG-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 65.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.74 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|