C58H39N4OP — CID 146549903
3-[3-[4-(4-diphenylphosphorylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6,10-diphenylphenanthridine (PubChem CID 146549903) has the molecular formula C58H39N4OP and a molecular weight of 838.95 g/mol. Its IUPAC name is 3-[3-[4-(4-diphenylphosphorylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6,10-diphenylphenanthridine.
| Compound Name | 3-[3-[4-(4-diphenylphosphorylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6,10-diphenylphenanthridine |
|---|---|
| PubChem CID | 146549903 |
| Molecular Formula | C58H39N4OP |
| Molecular Weight | 838.95 g/mol |
| Exact Mass | 838.29 |
| IUPAC Name | 3-[3-[4-(4-diphenylphosphorylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6,10-diphenylphenanthridine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc5c(c4)nc(-c4ccccc4)c4cccc(-c6ccccc6)c45)c3)n2)cc1 |
| InChI | InChI=1S/C58H39N4OP/c63-64(47-26-12-4-13-27-47,48-28-14-5-15-29-48)49-35-32-43(33-36-49)57-60-56(42-22-10-3-11-23-42)61-58(62-57)46-25-16-24-44(38-46)45-34-37-51-53(39-45)59-55(41-20-8-2-9-21-41)52-31-17-30-50(54(51)52)40-18-6-1-7-19-40/h1-39H |
| InChIKey | RROUUWDLJMNCEZ-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.95 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|