C52H35N4OP — CID 146548515
10-[3-[4-(4-diphenylphosphorylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-phenylphenanthridine (PubChem CID 146548515) has the molecular formula C52H35N4OP and a molecular weight of 762.85 g/mol. Its IUPAC name is 10-[3-[4-(4-diphenylphosphorylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-phenylphenanthridine.
| Compound Name | 10-[3-[4-(4-diphenylphosphorylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-phenylphenanthridine |
|---|---|
| PubChem CID | 146548515 |
| Molecular Formula | C52H35N4OP |
| Molecular Weight | 762.85 g/mol |
| Exact Mass | 762.25 |
| IUPAC Name | 10-[3-[4-(4-diphenylphosphorylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6-phenylphenanthridine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cccc5c(-c6ccccc6)nc6ccccc6c45)c3)n2)cc1 |
| InChI | InChI=1S/C52H35N4OP/c57-58(41-23-9-3-10-24-41,42-25-11-4-12-26-42)43-33-31-38(32-34-43)51-54-50(37-19-7-2-8-20-37)55-52(56-51)40-22-15-21-39(35-40)44-28-16-29-46-48(44)45-27-13-14-30-47(45)53-49(46)36-17-5-1-6-18-36/h1-35H |
| InChIKey | HICJMYMXWYCBPR-UHFFFAOYSA-N |
| XLogP | 11.55 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.85 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|