C47H31N6OP — CID 176877042
4-[4-(4-diphenylphosphorylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-phenyl-2H-imidazo[4,5-k]phenanthridine (PubChem CID 176877042) has the molecular formula C47H31N6OP and a molecular weight of 726.78 g/mol. Its IUPAC name is 4-[4-(4-diphenylphosphorylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-phenyl-2H-imidazo[4,5-k]phenanthridine.
| Compound Name | 4-[4-(4-diphenylphosphorylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-phenyl-2H-imidazo[4,5-k]phenanthridine |
|---|---|
| PubChem CID | 176877042 |
| Molecular Formula | C47H31N6OP |
| Molecular Weight | 726.78 g/mol |
| Exact Mass | 726.23 |
| IUPAC Name | 4-[4-(4-diphenylphosphorylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-6-phenyl-2H-imidazo[4,5-k]phenanthridine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2nc(-c3ccccc3)nc(-c3cc4c(-c5ccccc5)nc5ccccc5c4c4c3=NCN=4)n2)cc1 |
| InChI | InChI=1S/C47H31N6OP/c54-55(34-19-9-3-10-20-34,35-21-11-4-12-22-35)36-27-25-33(26-28-36)46-51-45(32-17-7-2-8-18-32)52-47(53-46)39-29-38-41(44-43(39)48-30-49-44)37-23-13-14-24-40(37)50-42(38)31-15-5-1-6-16-31/h1-29H,30H2 |
| InChIKey | YHXOHKPMBOVDOT-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 93.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.78 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|