C55H38N3OP — CID 140901945
2-[4-[4-(4-diphenylphosphorylphenyl)naphthalen-1-yl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 140901945) has the molecular formula C55H38N3OP and a molecular weight of 787.90 g/mol. Its IUPAC name is 2-[4-[4-(4-diphenylphosphorylphenyl)naphthalen-1-yl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[4-(4-diphenylphosphorylphenyl)naphthalen-1-yl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 140901945 |
| Molecular Formula | C55H38N3OP |
| Molecular Weight | 787.90 g/mol |
| Exact Mass | 787.28 |
| IUPAC Name | 2-[4-[4-(4-diphenylphosphorylphenyl)naphthalen-1-yl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccccc6)cc5)n4)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C55H38N3OP/c59-60(46-19-9-3-10-20-46,47-21-11-4-12-22-47)48-35-33-42(34-36-48)50-38-37-49(51-23-13-14-24-52(50)51)41-27-31-45(32-28-41)55-57-53(43-17-7-2-8-18-43)56-54(58-55)44-29-25-40(26-30-44)39-15-5-1-6-16-39/h1-38H |
| InChIKey | VZCVQQFBALDBFR-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.90 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|