C59H40N3OP — CID 140901903
2-[4-[4-(4-dinaphthalen-1-ylphosphorylphenyl)phenyl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 140901903) has the molecular formula C59H40N3OP and a molecular weight of 837.96 g/mol. Its IUPAC name is 2-[4-[4-(4-dinaphthalen-1-ylphosphorylphenyl)phenyl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[4-(4-dinaphthalen-1-ylphosphorylphenyl)phenyl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 140901903 |
| Molecular Formula | C59H40N3OP |
| Molecular Weight | 837.96 g/mol |
| Exact Mass | 837.29 |
| IUPAC Name | 2-[4-[4-(4-dinaphthalen-1-ylphosphorylphenyl)phenyl]phenyl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | O=P(c1ccc(-c2ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccccc6)cc5)n4)cc3)cc2)cc1)(c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C59H40N3OP/c63-64(55-23-11-19-47-15-7-9-21-53(47)55,56-24-12-20-48-16-8-10-22-54(48)56)52-39-37-46(38-40-52)44-27-25-43(26-28-44)45-31-35-51(36-32-45)59-61-57(49-17-5-2-6-18-49)60-58(62-59)50-33-29-42(30-34-50)41-13-3-1-4-14-41/h1-40H |
| InChIKey | AFWHWBYTJSJCHT-UHFFFAOYSA-N |
| XLogP | 13.82 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.96 |
| LogP ≤ 5 | 13.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|