C46H33N2OP — CID 140901998
4-[4-[4-(4-diphenylphosphorylphenyl)phenyl]phenyl]-2,6-diphenylpyrimidine (PubChem CID 140901998) has the molecular formula C46H33N2OP and a molecular weight of 660.76 g/mol. Its IUPAC name is 4-[4-[4-(4-diphenylphosphorylphenyl)phenyl]phenyl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[4-[4-(4-diphenylphosphorylphenyl)phenyl]phenyl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 140901998 |
| Molecular Formula | C46H33N2OP |
| Molecular Weight | 660.76 g/mol |
| Exact Mass | 660.23 |
| IUPAC Name | 4-[4-[4-(4-diphenylphosphorylphenyl)phenyl]phenyl]-2,6-diphenylpyrimidine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2ccc(-c3ccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)cc2)cc1 |
| InChI | InChI=1S/C46H33N2OP/c49-50(41-17-9-3-10-18-41,42-19-11-4-12-20-42)43-31-29-37(30-32-43)35-23-21-34(22-24-35)36-25-27-39(28-26-36)45-33-44(38-13-5-1-6-14-38)47-46(48-45)40-15-7-2-8-16-40/h1-33H |
| InChIKey | IUCCSTPQDCKDHN-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.76 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|