C42H32O2P2 — CID 102485161
1,3-bis(4-diphenylphosphorylphenyl)benzene (PubChem CID 102485161) has the molecular formula C42H32O2P2 and a molecular weight of 630.66 g/mol. Its IUPAC name is 1,3-bis(4-diphenylphosphorylphenyl)benzene.
| Compound Name | 1,3-bis(4-diphenylphosphorylphenyl)benzene |
|---|---|
| PubChem CID | 102485161 |
| Molecular Formula | C42H32O2P2 |
| Molecular Weight | 630.66 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | 1,3-bis(4-diphenylphosphorylphenyl)benzene |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2cccc(-c3ccc(P(=O)(c4ccccc4)c4ccccc4)cc3)c2)cc1 |
| InChI | InChI=1S/C42H32O2P2/c43-45(37-16-5-1-6-17-37,38-18-7-2-8-19-38)41-28-24-33(25-29-41)35-14-13-15-36(32-35)34-26-30-42(31-27-34)46(44,39-20-9-3-10-21-39)40-22-11-4-12-23-40/h1-32H |
| InChIKey | AAMAKFLIFWVBSW-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.66 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|