C50H35N2OP — CID 155273418
2-[4-[6-(4-diphenylphosphorylphenyl)naphthalen-2-yl]phenyl]-4,6-diphenylpyrimidine (PubChem CID 155273418) has the molecular formula C50H35N2OP and a molecular weight of 710.82 g/mol. Its IUPAC name is 2-[4-[6-(4-diphenylphosphorylphenyl)naphthalen-2-yl]phenyl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[4-[6-(4-diphenylphosphorylphenyl)naphthalen-2-yl]phenyl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 155273418 |
| Molecular Formula | C50H35N2OP |
| Molecular Weight | 710.82 g/mol |
| Exact Mass | 710.25 |
| IUPAC Name | 2-[4-[6-(4-diphenylphosphorylphenyl)naphthalen-2-yl]phenyl]-4,6-diphenylpyrimidine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2ccc3cc(-c4ccc(-c5nc(-c6ccccc6)cc(-c6ccccc6)n5)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C50H35N2OP/c53-54(45-17-9-3-10-18-45,46-19-11-4-12-20-46)47-31-29-37(30-32-47)42-26-28-43-33-41(25-27-44(43)34-42)36-21-23-40(24-22-36)50-51-48(38-13-5-1-6-14-38)35-49(52-50)39-15-7-2-8-16-39/h1-35H |
| InChIKey | VFFNNVHTYXBLRZ-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.82 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|