C39H24F4N3OP — CID 138605140
2,4-bis(3,5-difluorophenyl)-6-[4-(4-diphenylphosphorylphenyl)phenyl]-1,3,5-triazine (PubChem CID 138605140) has the molecular formula C39H24F4N3OP and a molecular weight of 657.61 g/mol. Its IUPAC name is 2,4-bis(3,5-difluorophenyl)-6-[4-(4-diphenylphosphorylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(3,5-difluorophenyl)-6-[4-(4-diphenylphosphorylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 138605140 |
| Molecular Formula | C39H24F4N3OP |
| Molecular Weight | 657.61 g/mol |
| Exact Mass | 657.16 |
| IUPAC Name | 2,4-bis(3,5-difluorophenyl)-6-[4-(4-diphenylphosphorylphenyl)phenyl]-1,3,5-triazine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2ccc(-c3nc(-c4cc(F)cc(F)c4)nc(-c4cc(F)cc(F)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C39H24F4N3OP/c40-30-19-28(20-31(41)23-30)38-44-37(45-39(46-38)29-21-32(42)24-33(43)22-29)27-13-11-25(12-14-27)26-15-17-36(18-16-26)48(47,34-7-3-1-4-8-34)35-9-5-2-6-10-35/h1-24H |
| InChIKey | QTXWNLQCCIWHCI-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.61 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|