C39H28N3PS — CID 140901933
[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 140901933) has the molecular formula C39H28N3PS and a molecular weight of 601.72 g/mol. Its IUPAC name is [4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-diphenyl-sulfanylidene-λ5-phosphane.
| Compound Name | [4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-diphenyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 140901933 |
| Molecular Formula | C39H28N3PS |
| Molecular Weight | 601.72 g/mol |
| Exact Mass | 601.17 |
| IUPAC Name | [4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | S=P(c1ccccc1)(c1ccccc1)c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C39H28N3PS/c44-43(34-17-9-3-10-18-34,35-19-11-4-12-20-35)36-27-25-30(26-28-36)29-21-23-33(24-22-29)39-41-37(31-13-5-1-6-14-31)40-38(42-39)32-15-7-2-8-16-32/h1-28H |
| InChIKey | DKYYBIUSEYWPSP-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.72 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|