C66H44N6 — CID 58943623
2-[4-[3-(3,5-diphenylphenyl)-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 58943623) has the molecular formula C66H44N6 and a molecular weight of 921.12 g/mol. Its IUPAC name is 2-[4-[3-(3,5-diphenylphenyl)-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[3-(3,5-diphenylphenyl)-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 58943623 |
| Molecular Formula | C66H44N6 |
| Molecular Weight | 921.12 g/mol |
| Exact Mass | 920.36 |
| IUPAC Name | 2-[4-[3-(3,5-diphenylphenyl)-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)cc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C66H44N6/c1-7-19-45(20-8-1)55-39-56(46-21-9-2-10-22-46)42-59(41-55)60-43-57(47-31-35-53(36-32-47)65-69-61(49-23-11-3-12-24-49)67-62(70-65)50-25-13-4-14-26-50)40-58(44-60)48-33-37-54(38-34-48)66-71-63(51-27-15-5-16-28-51)68-64(72-66)52-29-17-6-18-30-52/h1-44H |
| InChIKey | LEBREVRJMKITFC-UHFFFAOYSA-N |
| XLogP | 16.39 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.12 |
| LogP ≤ 5 | 16.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |