C45H28F2N3O2P — CID 138605256
2-[4-(4-diphenylphosphorylphenyl)dibenzofuran-2-yl]-4,6-bis(4-fluorophenyl)-1,3,5-triazine (PubChem CID 138605256) has the molecular formula C45H28F2N3O2P and a molecular weight of 711.71 g/mol. Its IUPAC name is 2-[4-(4-diphenylphosphorylphenyl)dibenzofuran-2-yl]-4,6-bis(4-fluorophenyl)-1,3,5-triazine.
| Compound Name | 2-[4-(4-diphenylphosphorylphenyl)dibenzofuran-2-yl]-4,6-bis(4-fluorophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 138605256 |
| Molecular Formula | C45H28F2N3O2P |
| Molecular Weight | 711.71 g/mol |
| Exact Mass | 711.19 |
| IUPAC Name | 2-[4-(4-diphenylphosphorylphenyl)dibenzofuran-2-yl]-4,6-bis(4-fluorophenyl)-1,3,5-triazine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2cc(-c3nc(-c4ccc(F)cc4)nc(-c4ccc(F)cc4)n3)cc3c2oc2ccccc23)cc1 |
| InChI | InChI=1S/C45H28F2N3O2P/c46-33-21-15-30(16-22-33)43-48-44(31-17-23-34(47)24-18-31)50-45(49-43)32-27-39(42-40(28-32)38-13-7-8-14-41(38)52-42)29-19-25-37(26-20-29)53(51,35-9-3-1-4-10-35)36-11-5-2-6-12-36/h1-28H |
| InChIKey | SRASQWWGZWSNGB-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.71 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|