C43H31N5O — CID 142453060
(1Z,3Z)-1-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]phenyl]-4-phenylbuta-1,3-diene-1,4-diamine (PubChem CID 142453060) has the molecular formula C43H31N5O and a molecular weight of 633.76 g/mol. Its IUPAC name is (1Z,3Z)-1-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]phenyl]-4-phenylbuta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3Z)-1-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]phenyl]-4-phenylbuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 142453060 |
| Molecular Formula | C43H31N5O |
| Molecular Weight | 633.76 g/mol |
| Exact Mass | 633.25 |
| IUPAC Name | (1Z,3Z)-1-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]phenyl]-4-phenylbuta-1,3-diene-1,4-diamine |
| SMILES | N/C(=C\C=C(/N)c1ccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc3c2oc2ccccc23)cc1)c1ccccc1 |
| InChI | InChI=1S/C43H31N5O/c44-37(29-12-4-1-5-13-29)24-25-38(45)30-22-20-28(21-23-30)35-26-33(27-36-34-18-10-11-19-39(34)49-40(35)36)43-47-41(31-14-6-2-7-15-31)46-42(48-43)32-16-8-3-9-17-32/h1-27H,44-45H2/b37-24-,38-25- |
| InChIKey | YUNHWJUQGFVJFV-TUPMYYBFSA-N |
| XLogP | 9.74 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.76 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|