C44H30N4O2 — CID 153355172
(1Z,3Z)-1-[2-(6,8-diphenyldibenzofuran-1-yl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]-4-phenylbuta-1,3-diene-1,4-diamine (PubChem CID 153355172) has the molecular formula C44H30N4O2 and a molecular weight of 646.75 g/mol. Its IUPAC name is (1Z,3Z)-1-[2-(6,8-diphenyldibenzofuran-1-yl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]-4-phenylbuta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3Z)-1-[2-(6,8-diphenyldibenzofuran-1-yl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]-4-phenylbuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 153355172 |
| Molecular Formula | C44H30N4O2 |
| Molecular Weight | 646.75 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | (1Z,3Z)-1-[2-(6,8-diphenyldibenzofuran-1-yl)-[1]benzofuro[3,2-d]pyrimidin-4-yl]-4-phenylbuta-1,3-diene-1,4-diamine |
| SMILES | N/C(=C\C=C(/N)c1nc(-c2cccc3oc4c(-c5ccccc5)cc(-c5ccccc5)cc4c23)nc2c1oc1ccccc12)c1ccccc1 |
| InChI | InChI=1S/C44H30N4O2/c45-35(29-17-8-3-9-18-29)23-24-36(46)41-43-40(31-19-10-11-21-37(31)49-43)47-44(48-41)32-20-12-22-38-39(32)34-26-30(27-13-4-1-5-14-27)25-33(42(34)50-38)28-15-6-2-7-16-28/h1-26H,45-46H2/b35-23-,36-24- |
| InChIKey | IGOFCMZFURKQSP-RXCNPGAZSA-N |
| XLogP | 10.58 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.75 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|