C58H40N2 — CID 175754260
4,6-bis(4-phenylphenyl)-2-[4-(2,4,5-triphenylphenyl)phenyl]pyrimidine (PubChem CID 175754260) has the molecular formula C58H40N2 and a molecular weight of 764.97 g/mol. Its IUPAC name is 4,6-bis(4-phenylphenyl)-2-[4-(2,4,5-triphenylphenyl)phenyl]pyrimidine.
| Compound Name | 4,6-bis(4-phenylphenyl)-2-[4-(2,4,5-triphenylphenyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 175754260 |
| Molecular Formula | C58H40N2 |
| Molecular Weight | 764.97 g/mol |
| Exact Mass | 764.32 |
| IUPAC Name | 4,6-bis(4-phenylphenyl)-2-[4-(2,4,5-triphenylphenyl)phenyl]pyrimidine |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc(-c5cc(-c6ccccc6)c(-c6ccccc6)cc5-c5ccccc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C58H40N2/c1-6-16-41(17-7-1)43-26-32-49(33-27-43)56-40-57(50-34-28-44(29-35-50)42-18-8-2-9-19-42)60-58(59-56)51-36-30-48(31-37-51)55-39-53(46-22-12-4-13-23-46)52(45-20-10-3-11-21-45)38-54(55)47-24-14-5-15-25-47/h1-40H |
| InChIKey | RQKMCBNRUCKODF-UHFFFAOYSA-N |
| XLogP | 15.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.97 |
| LogP ≤ 5 | 15.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |