C34H23ClN2 — CID 170004607
4-[4-(2-chlorophenyl)phenyl]-6-phenyl-2-(4-phenylphenyl)pyrimidine (PubChem CID 170004607) has the molecular formula C34H23ClN2 and a molecular weight of 495.03 g/mol. Its IUPAC name is 4-[4-(2-chlorophenyl)phenyl]-6-phenyl-2-(4-phenylphenyl)pyrimidine.
| Compound Name | 4-[4-(2-chlorophenyl)phenyl]-6-phenyl-2-(4-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 170004607 |
| Molecular Formula | C34H23ClN2 |
| Molecular Weight | 495.03 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 4-[4-(2-chlorophenyl)phenyl]-6-phenyl-2-(4-phenylphenyl)pyrimidine |
| SMILES | Clc1ccccc1-c1ccc(-c2cc(-c3ccccc3)nc(-c3ccc(-c4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C34H23ClN2/c35-31-14-8-7-13-30(31)26-17-19-28(20-18-26)33-23-32(27-11-5-2-6-12-27)36-34(37-33)29-21-15-25(16-22-29)24-9-3-1-4-10-24/h1-23H |
| InChIKey | JIRVTZPPCHRSII-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.03 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |