C37H25N5 — CID 129099147
2-[2-(4,6-diphenylpyrimidin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 129099147) has the molecular formula C37H25N5 and a molecular weight of 539.64 g/mol. Its IUPAC name is 2-[2-(4,6-diphenylpyrimidin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[2-(4,6-diphenylpyrimidin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 129099147 |
| Molecular Formula | C37H25N5 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 2-[2-(4,6-diphenylpyrimidin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)n2)cc1 |
| InChI | InChI=1S/C37H25N5/c1-5-15-26(16-6-1)32-25-33(27-17-7-2-8-18-27)39-36(38-32)30-23-13-14-24-31(30)37-41-34(28-19-9-3-10-20-28)40-35(42-37)29-21-11-4-12-22-29/h1-25H |
| InChIKey | OKHNODYOGUXISK-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |