C22H17N3 — CID 629613
4-(4,6-diphenylpyrimidin-2-yl)aniline (PubChem CID 629613) has the molecular formula C22H17N3 and a molecular weight of 323.40 g/mol. Its IUPAC name is 4-(4,6-diphenylpyrimidin-2-yl)aniline.
| Compound Name | 4-(4,6-diphenylpyrimidin-2-yl)aniline |
|---|---|
| PubChem CID | 629613 |
| Molecular Formula | C22H17N3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 4-(4,6-diphenylpyrimidin-2-yl)aniline |
| SMILES | Nc1ccc(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H17N3/c23-19-13-11-18(12-14-19)22-24-20(16-7-3-1-4-8-16)15-21(25-22)17-9-5-2-6-10-17/h1-15H,23H2 |
| InChIKey | MBNJYUMUJTXOGL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|