C21H17N5 — CID 630923
4-[2-(4-aminophenyl)-6-pyridin-3-ylpyrimidin-4-yl]aniline (PubChem CID 630923) has the molecular formula C21H17N5 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-[2-(4-aminophenyl)-6-pyridin-3-ylpyrimidin-4-yl]aniline.
| Compound Name | 4-[2-(4-aminophenyl)-6-pyridin-3-ylpyrimidin-4-yl]aniline |
|---|---|
| PubChem CID | 630923 |
| Molecular Formula | C21H17N5 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 4-[2-(4-aminophenyl)-6-pyridin-3-ylpyrimidin-4-yl]aniline |
| SMILES | Nc1ccc(-c2cc(-c3cccnc3)nc(-c3ccc(N)cc3)n2)cc1 |
| InChI | InChI=1S/C21H17N5/c22-17-7-3-14(4-8-17)19-12-20(16-2-1-11-24-13-16)26-21(25-19)15-5-9-18(23)10-6-15/h1-13H,22-23H2 |
| InChIKey | VOWLLFJYKSPVLM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|