About 4-pyridin-3-ylaniline;dihydrochloride
4-pyridin-3-ylaniline;dihydrochloride (PubChem CID 154574926) has the molecular formula C11H12Cl2N2
and a molecular weight of 243.14 g/mol. Its IUPAC name is 4-pyridin-3-ylaniline;dihydrochloride.
Molecular Properties
| Compound Name | 4-pyridin-3-ylaniline;dihydrochloride |
| PubChem CID | 154574926 |
| Molecular Formula | C11H12Cl2N2 |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 4-pyridin-3-ylaniline;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C11H10N2.2ClH/c12-11-5-3-9(4-6-11)10-2-1-7-13-8-10;;/h1-8H,12H2;2*1H |
| InChIKey | ZTFSDOGBTPTZEX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-pyridin-3-ylaniline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-3-ylaniline;dihydrochloride?
The IUPAC name of 4-pyridin-3-ylaniline;dihydrochloride (CID 154574926) is 4-pyridin-3-ylaniline;dihydrochloride.
What is the SMILES notation for 4-pyridin-3-ylaniline;dihydrochloride?
The canonical SMILES for 4-pyridin-3-ylaniline;dihydrochloride is Cl.Cl.Nc1ccc(-c2cccnc2)cc1.
What is the InChIKey of 4-pyridin-3-ylaniline;dihydrochloride?
The InChIKey is ZTFSDOGBTPTZEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2.2ClH/c12-11-5-3-9(4-6-11)10-2-1-7-13-8-10;;/h1-8H,12H2;2*1H.
What are the key properties of 4-pyridin-3-ylaniline;dihydrochloride?
4-pyridin-3-ylaniline;dihydrochloride has a molecular weight of 243.14 g/mol, XLogP of 3.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-3-ylaniline;dihydrochloride is sourced from PubChem (CID 154574926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).