About 4-(4-aminophenyl)aniline;ethane;bis(pyridine)
4-(4-aminophenyl)aniline;ethane;bis(pyridine) (PubChem CID 161174430) has the molecular formula C26H34N4
and a molecular weight of 402.59 g/mol. Its IUPAC name is 4-(4-aminophenyl)aniline;ethane;bis(pyridine).
Molecular Properties
| Compound Name | 4-(4-aminophenyl)aniline;ethane;bis(pyridine) |
| PubChem CID | 161174430 |
| Molecular Formula | C26H34N4 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 4-(4-aminophenyl)aniline;ethane;bis(pyridine) |
| SMILES | CC.CC.Nc1ccc(-c2ccc(N)cc2)cc1.c1ccncc1.c1ccncc1 |
| InChI | InChI=1S/C12H12N2.2C5H5N.2C2H6/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;2*1-2-4-6-5-3-1;2*1-2/h1-8H,13-14H2;2*1-5H;2*1-2H3 |
| InChIKey | URPOSONQHROAAE-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)aniline;ethane;bis(pyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)aniline;ethane;bis(pyridine)?
The IUPAC name of 4-(4-aminophenyl)aniline;ethane;bis(pyridine) (CID 161174430) is 4-(4-aminophenyl)aniline;ethane;bis(pyridine).
What is the SMILES notation for 4-(4-aminophenyl)aniline;ethane;bis(pyridine)?
The canonical SMILES for 4-(4-aminophenyl)aniline;ethane;bis(pyridine) is CC.CC.Nc1ccc(-c2ccc(N)cc2)cc1.c1ccncc1.c1ccncc1.
What is the InChIKey of 4-(4-aminophenyl)aniline;ethane;bis(pyridine)?
The InChIKey is URPOSONQHROAAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.2C5H5N.2C2H6/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;2*1-2-4-6-5-3-1;2*1-2/h1-8H,13-14H2;2*1-5H;2*1-2H3.
What are the key properties of 4-(4-aminophenyl)aniline;ethane;bis(pyridine)?
4-(4-aminophenyl)aniline;ethane;bis(pyridine) has a molecular weight of 402.59 g/mol, XLogP of 6.73, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)aniline;ethane;bis(pyridine) is sourced from PubChem (CID 161174430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).